51802-61-0 Usage
Uses
Used in Medicinal Chemistry:
5-METHYL-7-PHENYL-6,7-DIHYDRO-1H-1,4-DIAZEPINE-2,3-DICARBONITRILE is used as a building block for the synthesis of new drugs due to its unique molecular structure and potential biological activities.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 5-METHYL-7-PHENYL-6,7-DIHYDRO-1H-1,4-DIAZEPINE-2,3-DICARBONITRILE serves as a starting material for the development of novel chemical entities with therapeutic potential, leveraging its complex molecular framework for creating innovative medicines.
Check Digit Verification of cas no
The CAS Registry Mumber 51802-61-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,8,0 and 2 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 51802-61:
(7*5)+(6*1)+(5*8)+(4*0)+(3*2)+(2*6)+(1*1)=100
100 % 10 = 0
So 51802-61-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H12N4/c1-10-7-12(11-5-3-2-4-6-11)18-14(9-16)13(8-15)17-10/h2-6,12-13H,7H2,1H3/t12-,13+/m0/s1
