518064-16-9 Usage
Uses
Used in Pharmaceutical Industry:
1H-Pyrazole-4-methanamine,3,5-dimethyl-(9CI) is used as a pharmaceutical intermediate for the synthesis of various drugs and drug candidates. Its unique structure and chemical properties make it a promising candidate for the development of new therapeutic agents.
Used in Chemical Research:
1H-Pyrazole-4-methanamine,3,5-dimethyl-(9CI) is used as a research compound in the field of organic chemistry. It can be employed to study the reactivity, stability, and other properties of pyrazole derivatives, contributing to the advancement of chemical knowledge and the discovery of new chemical reactions.
Used in Material Science:
1H-Pyrazole-4-methanamine,3,5-dimethyl-(9CI) may have potential applications in material science, such as the development of new polymers, coatings, or other materials with unique properties. Its chemical structure and reactivity could be utilized to create novel materials with specific characteristics for various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 518064-16-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,1,8,0,6 and 4 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 518064-16:
(8*5)+(7*1)+(6*8)+(5*0)+(4*6)+(3*4)+(2*1)+(1*6)=139
139 % 10 = 9
So 518064-16-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H11N3/c1-4-6(3-7)5(2)9-8-4/h3,7H2,1-2H3,(H,8,9)
