51838-83-6 Usage
Uses
Used in Pharmaceutical Industry:
3,3a,7a,9b-Tetrahydro-3-(1-hydroxyethyl)-2-oxo-2H,4aH-1,4,5-trioxadicyclopent[a,hi]indene-7-carboxylic acid methyl ester is used as a pharmaceutical compound for its potential therapeutic applications. Its unique structure and functional groups may contribute to its biological activity, making it a candidate for the development of new drugs and treatments.
Used in Chemical Research:
3,3a,7a,9b-Tetrahydro-3-(1-hydroxyethyl)-2-oxo-2H,4aH-1,4,5-trioxadicyclopent[a,hi]indene-7-carboxylic acid methyl ester is used as a research compound in the field of organic chemistry. Its complex structure and functional groups provide opportunities for studying its reactivity, synthesis, and potential applications in various chemical processes.
Used in Material Science:
3,3a,7a,9b-Tetrahydro-3-(1-hydroxyethyl)-2-oxo-2H,4aH-1,4,5-trioxadicyclopent[a,hi]indene-7-carboxylic acid methyl ester is used as a material in material science for its potential properties and applications. Its unique structure and functional groups may offer new opportunities for the development of advanced materials with specific properties and uses in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 51838-83-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,8,3 and 8 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 51838-83:
(7*5)+(6*1)+(5*8)+(4*3)+(3*8)+(2*8)+(1*3)=136
136 % 10 = 6
So 51838-83-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H16O7/c1-6(16)9-11-15(22-13(9)18)4-3-7-8(12(17)19-2)5-20-14(21-11)10(7)15/h3-7,9-11,14,16H,1-2H3
