5191-97-9 Usage
Uses
Used in Pharmaceutical Industry:
L-Ornithine 2-oxoglutarate is used as an active pharmaceutical ingredient for the development of medications that target specific health conditions. Its role in the urea cycle and its potential to improve nitrogen metabolism make it a valuable compound in the treatment of various medical conditions.
Used in Nutritional Supplements:
L-Ornithine 2-oxoglutarate is also used as a dietary supplement to support overall health and well-being. It is believed to have potential benefits for muscle growth, immune function, and liver health, making it a popular choice for athletes and individuals looking to improve their physical performance and maintain a healthy lifestyle.
Used in Research and Development:
Due to its unique chemical properties and potential therapeutic applications, L-Ornithine 2-oxoglutarate is utilized in research and development for the discovery of new drugs and therapies. Its involvement in various metabolic pathways and its ability to interact with other biological molecules make it an interesting subject for scientific investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 5191-97-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,1,9 and 1 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5191-97:
(6*5)+(5*1)+(4*9)+(3*1)+(2*9)+(1*7)=99
99 % 10 = 9
So 5191-97-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H12N2O2.C5H6O5/c6-3-1-2-4(7)5(8)9;6-3(5(9)10)1-2-4(7)8/h4H,1-3,6-7H2,(H,8,9);1-2H2,(H,7,8)(H,9,10)/t4-;/m0./s1
