5196-95-2 Usage
Uses
Used in Pharmaceutical Industry:
6-(4-CHLOROPHENYL)-3-MORPHOLINONE is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new medicinal compounds. Its unique structure allows it to be a key component in the creation of various drugs.
Used in Agrochemical Industry:
In the agrochemical sector, 6-(4-CHLOROPHENYL)-3-MORPHOLINONE serves as an intermediate, playing a crucial role in the synthesis of agrochemicals that are vital for agricultural applications, such as pesticides and herbicides.
Used in Dye and Pigment Production:
6-(4-CHLOROPHENYL)-3-MORPHOLINONE is utilized as a building block in the production of dyes and pigments, where its chemical properties contribute to the color and stability of these products.
Used in Chemical Research and Development:
6-(4-CHLOROPHENYL)-3-MORPHOLINONE is also employed in the research and development of new chemical compounds across various industries. Its versatility and stability make it an attractive candidate for the exploration of novel chemical entities and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 5196-95-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,1,9 and 6 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5196-95:
(6*5)+(5*1)+(4*9)+(3*6)+(2*9)+(1*5)=112
112 % 10 = 2
So 5196-95-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H10ClNO2/c11-8-3-1-7(2-4-8)9-5-12-10(13)6-14-9/h1-4,9H,5-6H2,(H,12,13)/t9-/m0/s1
