51991-94-7 Usage
General Description
5-OXO-5H-[1,3]THIAZOLO[3,2-A]PYRIMIDINE-6-CARBOXYLIC ACID is a chemical compound with a complex molecular structure. It is a heterocyclic compound containing both nitrogen and sulfur atoms. The carboxylic acid group in its structure makes it a potential ligand for metal ions, and it has potential applications in coordination chemistry. 5-OXO-5H-[1,3]THIAZOLO[3,2-A]PYRIMIDINE-6-CARBOXYLICACID may also have pharmacological properties due to its unique structure, and further research is needed to explore its potential as a drug candidate. Its complex structure and potential properties make it an interesting compound for further study and potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 51991-94-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,9,9 and 1 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 51991-94:
(7*5)+(6*1)+(5*9)+(4*9)+(3*1)+(2*9)+(1*4)=147
147 % 10 = 7
So 51991-94-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H4N2O3S/c10-5-4(6(11)12)3-8-7-9(5)1-2-13-7/h1-3H,(H,11,12)
51991-94-7Relevant articles and documents
Exotic amino acids. 4. Synthesis of methyl esters of some N-heteroamino-methylenemalonic acids
Zicane,Ravinya,Tetere,Rijkure,Gudriniece,Kalejs
, p. 754 - 757 (2007/10/03)
Isopropylidene N-hetarylaminomethylenenzalonates, obtained from isopropylidene ethoxymethylenemalonate and 2-aminopyridine, 2-amino-5-methylpyridine, 2-aminopyrimidine, 7-amino-4-methylcoumarin, and 2-amino-3,5-diethoxycarbonyl-4-methylthiophene, undergo
Penicillins
-
, (2008/06/13)
A class of α-(heterocyclic carbonylamino) penicillins in which the heterocyclic group of the acyl moiety is a fused bicyclic ring having a nitrogen atom at the bridge position, shows good antibacterial activity.
