52033-70-2 Usage
Uses
Used in Pharmaceutical Industry:
2-NITRO-5-(PHENYLACETYLAMINO)-BENZOIC ACID is used as an intermediate in the synthesis of pharmaceuticals for its ability to participate in various chemical reactions and processes. Its presence of functional groups allows for the creation of diverse bioactive molecules with potential therapeutic effects.
Used in Organic Compounds Synthesis:
In the field of organic chemistry, 2-NITRO-5-(PHENYLACETYLAMINO)-BENZOIC ACID serves as a key intermediate for the preparation of other organic compounds. Its versatile structure facilitates its use in the development of new chemical entities with specific properties and applications.
Used in Medicinal Chemistry:
2-NITRO-5-(PHENYLACETYLAMINO)-BENZOIC ACID is utilized in medicinal chemistry as a building block for designing and developing new pharmaceuticals. Its structural features enable the creation of molecules with potential medicinal applications, contributing to the advancement of drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 52033-70-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,0,3 and 3 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 52033-70:
(7*5)+(6*2)+(5*0)+(4*3)+(3*3)+(2*7)+(1*0)=82
82 % 10 = 2
So 52033-70-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H12N2O5/c18-14(8-10-4-2-1-3-5-10)16-11-6-7-13(17(21)22)12(9-11)15(19)20/h1-7,9H,8H2,(H,16,18)(H,19,20)
