52049-26-0 Usage
Uses
Used in Pharmaceutical Industry:
1-(2-chloroethyl)-3-(4-hydroxycyclohexyl)-1-nitroso-urea is used as an active pharmaceutical ingredient for its antitumor activity. 1-(2-chloroethyl)-3-(4-hydroxycyclohexyl)-1-nitroso-urea is particularly effective against various types of cancer due to its ability to cross-link and alkylate DNA, leading to the disruption of cellular replication and ultimately causing cell death. Its potent anti-cancer properties make it a valuable component in the development of cancer therapeutics.
Used in Cancer Research:
In the field of cancer research, 1-(2-chloroethyl)-3-(4-hydroxycyclohexyl)-1-nitroso-urea serves as a crucial compound for studying the mechanisms of action and potential applications of chloroethylnitrosourea derivatives. Researchers utilize 1-(2-chloroethyl)-3-(4-hydroxycyclohexyl)-1-nitroso-urea to investigate its interactions with biological targets, such as DNA and proteins, to better understand its anti-cancer effects and to develop more effective cancer treatments.
Used in Drug Development:
1-(2-chloroethyl)-3-(4-hydroxycyclohexyl)-1-nitroso-urea is also used in the development of novel drug formulations and delivery systems. Its unique chemical properties and potent anti-cancer activity make it an attractive candidate for the design of new drug delivery systems, such as nanoparticles or liposomes, which can improve the bioavailability, targeting, and overall efficacy of the compound in cancer treatment.
Check Digit Verification of cas no
The CAS Registry Mumber 52049-26-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,0,4 and 9 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 52049-26:
(7*5)+(6*2)+(5*0)+(4*4)+(3*9)+(2*2)+(1*6)=100
100 % 10 = 0
So 52049-26-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H16ClN3O3/c10-5-6-13(12-16)9(15)11-7-1-3-8(14)4-2-7/h7-8,14H,1-6H2,(H,11,15)
