52069-54-2 Usage
Uses
Used in Pharmaceutical Industry:
Potassium [(cyanomethyl)thio]acetate is used as a reactant for the synthesis of various pharmaceutical compounds. Its reactivity allows for the creation of new drug molecules, contributing to the development of novel treatments and medications.
Used in Scientific Research:
In the field of scientific research, potassium [(cyanomethyl)thio]acetate is used as a reactant to explore its chemical properties and potential applications. Researchers utilize Potassium [(cyanomethyl)thio]acetate to study its interactions with other substances and to develop new methodologies for chemical synthesis.
Used in Industrial Processes:
Potassium [(cyanomethyl)thio]acetate is employed in various industrial processes as a reactant to produce a range of chemical products. Its versatility and reactivity make it a valuable component in the synthesis of compounds used in different industries, such as agriculture, textiles, and materials science.
Safety Measures:
Due to the potential toxicity and reactivity of potassium [(cyanomethyl)thio]acetate, certain safety measures are required when handling Potassium [(cyanomethyl)thio]acetate. It is essential to follow proper guidelines and protocols to minimize risks and ensure the safe use of this substance in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 52069-54-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,0,6 and 9 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 52069-54:
(7*5)+(6*2)+(5*0)+(4*6)+(3*9)+(2*5)+(1*4)=112
112 % 10 = 2
So 52069-54-2 is a valid CAS Registry Number.
InChI:InChI=1/C4H5NO2S.K/c5-1-2-8-3-4(6)7;/h2-3H2,(H,6,7);/q;+1/p-1
