52075-14-6 Usage
Uses
Used in Pharmaceutical Industry:
(4S,5S)-(-)-4-METHOXYMETHYL-2-METHYL-5-PHENYL-2-OXAZOLINE is used as a chiral ligand in asymmetric synthesis and catalysis for the production of pharmaceuticals. Its chiral properties enable the creation of enantiomerically pure compounds, which is crucial for the development of drugs with specific biological activities and reduced side effects.
Used in Agrochemical Industry:
In the agrochemical sector, (4S,5S)-(-)-4-METHOXYMETHYL-2-METHYL-5-PHENYL-2-OXAZOLINE serves as a chiral ligand in asymmetric synthesis, aiding in the production of agrochemicals with enhanced selectivity and reduced environmental impact. The ability to create optically pure compounds ensures that the agrochemicals target specific pests while minimizing harm to non-target organisms.
Used in Fine Chemicals Industry:
(4S,5S)-(-)-4-METHOXYMETHYL-2-METHYL-5-PHENYL-2-OXAZOLINE is utilized as a chiral ligand in the synthesis of fine chemicals, which are high-purity chemicals used in various applications such as fragrances, flavors, and specialty materials. Its role in asymmetric synthesis ensures the production of high-quality enantiomerically pure compounds for these applications.
Used in Resolution of Racemic Mixtures:
(4S,5S)-(-)-4-METHOXYMETHYL-2-METHYL-5-PHENYL-2-OXAZOLINE is employed in the resolution of racemic mixtures to separate enantiomers and produce optically pure compounds. This process is essential for obtaining the desired enantiomer with specific properties, which is particularly important in the synthesis of chiral drugs and other chiral molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 52075-14-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,0,7 and 5 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 52075-14:
(7*5)+(6*2)+(5*0)+(4*7)+(3*5)+(2*1)+(1*4)=96
96 % 10 = 6
So 52075-14-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO2/c1-9-13-11(8-14-2)12(15-9)10-6-4-3-5-7-10/h3-7,11-12H,8H2,1-2H3/t11-,12+/m1/s1
