52075-14-6 Usage
General Description
The chemical (4S,5S)-(-)-4-methoxymethyl-2-methyl-5-phenyl-2-oxazoline is a chiral molecule with a specific stereochemistry. It consists of a heterocyclic ring structure containing oxygen and nitrogen atoms, as well as a phenyl and a methyl group. (4S,5S)-(-)-4-METHOXYMETHYL-2-METHYL-5-PHENYL-2-OXAZOLINE is commonly used as a chiral ligand in asymmetric synthesis and catalysis. Its chiral nature allows it to selectively interact with other molecules in chemical reactions, making it valuable in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, it is also used in the resolution of racemic mixtures, where it can separate enantiomers and produce optically pure compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 52075-14-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,0,7 and 5 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 52075-14:
(7*5)+(6*2)+(5*0)+(4*7)+(3*5)+(2*1)+(1*4)=96
96 % 10 = 6
So 52075-14-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO2/c1-9-13-11(8-14-2)12(15-9)10-6-4-3-5-7-10/h3-7,11-12H,8H2,1-2H3/t11-,12+/m1/s1