52112-67-1 Usage
Description
5,7-Dibromo-2-benzoxazolamine is a chemical compound with the molecular formula C7H4Br2N2O. It is a benzoxazolamine derivative that contains two bromine atoms and a benzoxazole ring. 5,7-Dibromo-2-benzoxazolamine is known for its high reactivity and is commonly used as a building block in the synthesis of pharmaceuticals, agrochemicals, and materials science. Additionally, it has been studied for its potential use as a fluorescent probe for the detection of metal ions.
Uses
Used in Pharmaceutical Industry:
5,7-Dibromo-2-benzoxazolamine is used as a building block for the synthesis of various pharmaceuticals. Its high reactivity allows for the creation of a wide range of chemical reactions, making it a valuable component in the development of new drugs.
Used in Agrochemical Industry:
In the agrochemical industry, 5,7-Dibromo-2-benzoxazolamine is utilized as a key component in the synthesis of various agrochemicals. Its ability to participate in numerous chemical reactions contributes to the development of effective products for agricultural applications.
Used in Materials Science:
5,7-Dibromo-2-benzoxazolamine is employed in materials science for the synthesis of advanced materials. Its unique properties and reactivity make it suitable for creating innovative materials with specific characteristics for various applications.
Used as a Fluorescent Probe in Analytical Chemistry:
5,7-Dibromo-2-benzoxazolamine has been studied for its potential use as a fluorescent probe for the detection of metal ions. Its ability to fluoresce in the presence of certain metal ions makes it a promising candidate for analytical chemistry applications, particularly in the field of metal ion detection and analysis.
Check Digit Verification of cas no
The CAS Registry Mumber 52112-67-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,1,1 and 2 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 52112-67:
(7*5)+(6*2)+(5*1)+(4*1)+(3*2)+(2*6)+(1*7)=81
81 % 10 = 1
So 52112-67-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H4Br2N2O/c8-3-1-4(9)6-5(2-3)11-7(10)12-6/h1-2H,(H2,10,11)
