52128-43-5 Usage
General Description
2,4-Diamino-5-chloro-6-[(3,4-dichloroanilino)methyl]quinazoline is a chemical compound with the molecular formula C16H12Cl4N6. It belongs to the class of quinazoline compounds and is known for its potential biological activities, particularly as an inhibitor for certain enzymes. This chemical has been studied for its potential application in the treatment of various diseases, including cancer and diabetes. It is also used as a reference standard in analytical chemistry and pharmaceutical research. The compound is characterized by its quinazoline ring structure with amino and chloro substituents, which contribute to its biological and chemical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 52128-43-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,1,2 and 8 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 52128-43:
(7*5)+(6*2)+(5*1)+(4*2)+(3*8)+(2*4)+(1*3)=95
95 % 10 = 5
So 52128-43-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H12Cl3N5/c16-9-3-2-8(5-10(9)17)21-6-7-1-4-11-12(13(7)18)14(19)23-15(20)22-11/h1-5,21H,6H2,(H4,19,20,22,23)