52176-13-3 Usage
Uses
Used in Pharmaceutical Synthesis:
5-bromo-1H,5H-pyrimidine-4,6-dione is utilized as a key intermediate in the synthesis of pharmaceuticals for its ability to be incorporated into the molecular structures of various drugs. Its unique reactivity and properties allow for the development of new therapeutic agents with specific medicinal properties.
Used in Agrochemical Production:
In the agrochemical industry, 5-bromo-1H,5H-pyrimidine-4,6-dione serves as a building block for the creation of compounds used in crop protection and pest control. Its chemical structure contributes to the effectiveness of these agrochemicals, enhancing their performance in agricultural applications.
Used in Material Science:
5-bromo-1H,5H-pyrimidine-4,6-dione is employed in material science for its potential to contribute to the development of new materials with specific properties. Its structural characteristics make it a valuable component in the research and creation of advanced materials for various applications.
Used in Organic Synthesis as a Building Block:
As a versatile chemical, 5-bromo-1H,5H-pyrimidine-4,6-dione is used as a building block in organic synthesis, allowing chemists to construct a wide range of organic compounds for different purposes. Its reactivity and structural features facilitate the synthesis of complex organic molecules for use in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 52176-13-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,1,7 and 6 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 52176-13:
(7*5)+(6*2)+(5*1)+(4*7)+(3*6)+(2*1)+(1*3)=103
103 % 10 = 3
So 52176-13-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H3BrN2O2/c5-2-3(8)6-1-7-4(2)9/h1-2H,(H,6,7,8,9)
