52181-07-4 Usage
Molecular weight
327.83 g/mol the mass of one mole of 1-benzyl-4-methylquinolinium chloride.
Type of compound
Quaternary ammonium compound a compound containing a central nitrogen atom with four organic groups attached, positively charged.
Core structure
Quinolinium a bicyclic aromatic compound consisting of a benzene ring fused to a pyridine ring.
Substituents
Benzyl group (C6H5CH2-) and methyl group (CH3-) two organic groups attached to the quinolinium core, influencing the compound's properties and reactivity.
Uses
Reagent in organic synthesis used to facilitate chemical reactions and synthesize various organic compounds.
Intermediate in pharmaceutical production
Involved in the production of various pharmaceuticals and organic compounds.
Application in biochemical research
Utilized in studying biological processes and systems.
Antimicrobial agent
Exhibits antimicrobial properties, used to kill or inhibit the growth of microorganisms.
Potential drug development
Studied for its pharmacological properties and possible application in the development of new drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 52181-07-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,1,8 and 1 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 52181-07:
(7*5)+(6*2)+(5*1)+(4*8)+(3*1)+(2*0)+(1*7)=94
94 % 10 = 4
So 52181-07-4 is a valid CAS Registry Number.
InChI:InChI=1/C17H16N.ClH/c1-14-11-12-18(13-15-7-3-2-4-8-15)17-10-6-5-9-16(14)17;/h2-12H,13H2,1H3;1H/q+1;/p-1
