52196-90-4 Usage
Uses
Used in Pharmaceutical Industry:
5-Benzyl-3-pyridinol is used as a key building block for the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique molecular structure allows for the creation of compounds with specific biological activities, making it a valuable component in medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 5-Benzyl-3-pyridinol is employed as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. Its reactivity and molecular properties enable the production of effective compounds for agricultural applications, enhancing crop protection and yield.
Used in Organic Synthesis:
5-Benzyl-3-pyridinol is utilized as an intermediate in the production of other organic compounds, playing a crucial role in chemical synthesis. Its versatility allows for the creation of a wide range of products, from specialty chemicals to advanced materials, for various industrial applications.
Used in Research and Development:
In the field of research and development, 5-Benzyl-3-pyridinol is employed as a valuable component in the exploration of new chemical reactions and the synthesis of novel compounds. Its unique properties and reactivity make it an essential tool for scientists and researchers working on the cutting edge of chemical innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 52196-90-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,1,9 and 6 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 52196-90:
(7*5)+(6*2)+(5*1)+(4*9)+(3*6)+(2*9)+(1*0)=124
124 % 10 = 4
So 52196-90-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H11NO/c14-12-7-11(8-13-9-12)6-10-4-2-1-3-5-10/h1-5,7-9,14H,6H2
