52231-50-2 Usage
Structure
1,3-benzothiazol-3-ium core with a 6-(dimethylamino)hexa-1,3,5-trienyl group
The core structure of the compound is a 1,3-benzothiazol-3-ium, which is a heterocyclic compound containing sulfur. The 6-(dimethylamino)hexa-1,3,5-trienyl group is attached to this core, providing the compound with its unique properties.
8. Iodide salt
The compound exists as an iodide salt, which means it contains an iodide ion (I-) as a counterion to the positively charged 1,3-benzothiazol-3-ium cation.
Check Digit Verification of cas no
The CAS Registry Mumber 52231-50-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,2,3 and 1 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 52231-50:
(7*5)+(6*2)+(5*2)+(4*3)+(3*1)+(2*5)+(1*0)=82
82 % 10 = 2
So 52231-50-2 is a valid CAS Registry Number.
InChI:InChI=1/C17H21N2S.HI/c1-4-19-15-11-8-9-12-16(15)20-17(19)13-7-5-6-10-14-18(2)3;/h5-14H,4H2,1-3H3;1H/q+1;/p-1