522644-09-3 Usage
Uses
Used in Organic Synthesis:
(1S,2R)-(+)-2-Aminocycloheptanecarboxylic acid hydrochloride serves as a reagent in organic synthesis, providing a versatile building block for the creation of complex organic molecules. Its cycloheptane ring and functional groups offer multiple sites for further chemical reactions, making it a valuable component in the synthesis of pharmaceuticals and other organic compounds.
Used in Pharmaceutical Research:
In pharmaceutical research, (1S,2R)-(+)-2-Aminocycloheptanecarboxylic acid hydrochloride is utilized as a precursor for the development of chiral ligands and building blocks. Its chiral nature is crucial for the synthesis of biologically active molecules, which often exhibit different pharmacological effects based on their stereochemistry. (1S,2R)-(+)-2-Aminocycloheptanecarboxylic acid hydrochloride aids in the production of enantiomerically pure compounds, which is vital for ensuring the desired therapeutic effects and minimizing potential side effects.
Used in the Preparation of Chiral Ligands:
(1S,2R)-(+)-2-Aminocycloheptanecarboxylic acid hydrochloride is employed in the preparation of chiral ligands, which are essential in asymmetric catalysis and enantioselective synthesis. These ligands can induce chirality in the products of chemical reactions, leading to the formation of enantiomerically pure compounds. This is particularly important in the synthesis of pharmaceuticals, where the desired biological activity is often associated with a specific enantiomer.
Used in the Synthesis of Biologically Active Molecules:
(1S,2R)-(+)-2-Aminocycloheptanecarboxylic acid hydrochloride is also used as a building block in the synthesis of biologically active molecules, such as drugs and agrochemicals. Its unique structure and functional groups allow for the creation of molecules with specific biological activities, contributing to the development of new therapeutic agents and other bioactive compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 522644-09-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,2,2,6,4 and 4 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 522644-09:
(8*5)+(7*2)+(6*2)+(5*6)+(4*4)+(3*4)+(2*0)+(1*9)=133
133 % 10 = 3
So 522644-09-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H15NO2.ClH/c9-7-5-3-1-2-4-6(7)8(10)11;/h6-7H,1-5,9H2,(H,10,11);1H/t6-,7+;/m0./s1
