522651-42-9 Usage
Uses
Used in Pharmaceutical Industry:
Sodium 2,5-difluorobenzoate is used as a key intermediate in the synthesis of various drugs. Its unique chemical structure allows for the development of new pharmaceutical compounds with improved therapeutic properties.
Used in Agrochemical Industry:
Sodium 2,5-difluorobenzoate is used as a precursor in the production of agrochemicals, such as pesticides and herbicides. Its incorporation into these products enhances their effectiveness in controlling pests and weeds, contributing to increased crop yields and agricultural productivity.
Used as a Reagent in Organic Chemical Reactions:
Sodium 2,5-difluorobenzoate is used as a reagent in the formation of esters and amides, which are essential components in the synthesis of various organic compounds. Its ability to participate in these reactions makes it a valuable tool in organic chemistry research and development.
Overall, Sodium 2,5-difluorobenzoate plays a crucial role in the development and production of pharmaceuticals, agrochemicals, and other organic compounds, thanks to its unique properties and wide range of applications.
Check Digit Verification of cas no
The CAS Registry Mumber 522651-42-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,2,2,6,5 and 1 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 522651-42:
(8*5)+(7*2)+(6*2)+(5*6)+(4*5)+(3*1)+(2*4)+(1*2)=129
129 % 10 = 9
So 522651-42-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H4F2O2.Na/c8-4-1-2-6(9)5(3-4)7(10)11;/h1-3H,(H,10,11);/q;+1/p-1
