5227-51-0 Usage
Uses
Used in Organic Chemistry Research:
1-Methylazepane-2-carboxylic acid is used as a research compound for studying its chemical properties and potential applications in organic chemistry. Its unique structure and functional groups make it a valuable tool for understanding the behavior of similar compounds and developing new synthetic pathways.
Used in Synthesis of Organic Products:
1-Methylazepane-2-carboxylic acid is used as a building block in the synthesis of various organic products. Its carboxylic acid group can participate in various chemical reactions, such as esterification, amidation, and condensation, enabling the creation of a wide range of compounds with diverse applications.
Used in Pharmaceutical Industry:
1-Methylazepane-2-carboxylic acid is used as a starting material or intermediate in the synthesis of pharmaceutical compounds. Its unique structure and functional groups can be modified to create new drug candidates with potential therapeutic properties.
Used in Material Science:
1-Methylazepane-2-carboxylic acid can be used in the development of new materials with specific properties, such as polymers, coatings, or adhesives. Its ability to participate in various chemical reactions allows for the creation of materials with tailored characteristics for specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 5227-51-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,2,2 and 7 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 5227-51:
(6*5)+(5*2)+(4*2)+(3*7)+(2*5)+(1*1)=80
80 % 10 = 0
So 5227-51-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H15NO2/c1-9-6-4-2-3-5-7(9)8(10)11/h7H,2-6H2,1H3,(H,10,11)
