52334-51-7 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
2-Hydroxy-3-amino-5-picoline is used as a building block for the synthesis of pharmaceuticals and agrochemicals, contributing to the development of new drugs and pesticides due to its unique molecular structure and reactivity.
Used in Coordination Chemistry:
In coordination chemistry, 2-Hydroxy-3-amino-5-picoline serves as a ligand, playing a crucial role in the formation of coordination compounds. Its ability to bind with metal ions enhances the stability and properties of these compounds.
Used in Dyes and Pigments Production:
2-Hydroxy-3-amino-5-picoline is used as a precursor in the production of dyes and pigments, where its chemical properties contribute to the color and stability of the final products.
Used in Materials Science:
In the field of materials science, 2-Hydroxy-3-amino-5-picoline has potential applications in the development of organic electronic devices and catalysts. Its structural features make it a promising candidate for enhancing the performance of these advanced materials.
Overall, 2-Hydroxy-3-amino-5-picoline's diverse applications reflect its importance as a versatile compound in chemistry and materials science, with potential for further exploration and development in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 52334-51-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,3,3 and 4 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 52334-51:
(7*5)+(6*2)+(5*3)+(4*3)+(3*4)+(2*5)+(1*1)=97
97 % 10 = 7
So 52334-51-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O/c1-4-2-5(7)6(9)8-3-4/h2-3H,7H2,1H3,(H,8,9)
52334-51-7Relevant academic research and scientific papers
7-HYDROXY-INDOLINYL ANTAGONISTS OF P2Y1 RECEPTOR
-
Paragraph 00265, (2014/02/16)
The present invention provides compounds of Formula (I): Formula (I) as defined in the specification and compositions comprising any of such novel compounds. These compounds are antagonists of P2Y1 receptor which may be used medicaments.
3-(BIARYLOXY) PROPIONIC ACID DERIVATIVE
-
Page/Page column 43, (2012/07/14)
A compound of the general formula (I): [wherein, R1 represents a halogen atom, or the like, R2 represents a hydrogen atom, or the like, R3 and R4, each independently, represent a hydrogen atom, a C1-4
