52357-17-2 Usage
Check Digit Verification of cas no
The CAS Registry Mumber 52357-17-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,3,5 and 7 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 52357-17:
(7*5)+(6*2)+(5*3)+(4*5)+(3*7)+(2*1)+(1*7)=112
112 % 10 = 2
So 52357-17-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H17ClN2O2/c1-4-7-14-9(12)8(5-2)10(15)13(6-3)11(14)16/h4-7H2,1-3H3
52357-17-2Relevant academic research and scientific papers
Fungicidally active uracil derivatives
-
, (2008/06/13)
Uracil derivatives having the general formula: STR1 wherein R1 and R3 are each an alkyl group of 2 to 10 carbon atoms or an alkenyl group of 3 to 10 carbon atoms, R5 is an alkyl group of 2 to 5 carbon atoms and X is a hydrogen or halogen atom. These compounds are characterized by their fungicidal activity.