5238-66-4 Usage
Uses
Used in Pharmaceutical Synthesis:
(5-BROMO-1,3-DIOXO-1,3-DIHYDRO-ISOINDOL-2-YL)-ACETIC ACID is used as a key intermediate for the synthesis of various pharmaceuticals. Its unique structural properties and reactivity contribute to the development of new drugs with potential therapeutic applications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, (5-BROMO-1,3-DIOXO-1,3-DIHYDRO-ISOINDOL-2-YL)-ACETIC ACID serves as a valuable compound for the design and development of novel therapeutic agents. Its structural features allow for the exploration of new chemical spaces and the creation of innovative drug candidates.
Used in Drug Discovery:
(5-BROMO-1,3-DIOXO-1,3-DIHYDRO-ISOINDOL-2-YL)-ACETIC ACID is utilized in drug discovery processes to identify potential lead compounds with therapeutic potential. Its unique chemical properties make it an attractive starting point for the development of new drugs targeting various diseases and conditions.
Used in the Development of New Materials:
(5-BROMO-1,3-DIOXO-1,3-DIHYDRO-ISOINDOL-2-YL)-ACETIC ACID may also have potential uses in the development of new materials, thanks to its structural properties and reactivity. (5-BROMO-1,3-DIOXO-1,3-DIHYDRO-ISOINDOL-2-YL)-ACETIC ACID could be a key component in the creation of advanced materials with specific properties for various applications.
Used in Chemical Intermediates:
In the chemical industry, (5-BROMO-1,3-DIOXO-1,3-DIHYDRO-ISOINDOL-2-YL)-ACETIC ACID serves as an important intermediate for the production of other organic compounds. Its versatility and reactivity make it a valuable asset in the synthesis of a wide range of chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 5238-66-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,2,3 and 8 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5238-66:
(6*5)+(5*2)+(4*3)+(3*8)+(2*6)+(1*6)=94
94 % 10 = 4
So 5238-66-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H6BrNO4/c11-5-1-2-6-7(3-5)10(16)12(9(6)15)4-8(13)14/h1-3H,4H2,(H,13,14)
