5239-39-4 Usage
Uses
Used in Pharmaceutical Industry:
6,6-Dimethylpiperidine-2,4-dione is used as a chemical intermediate for the synthesis of various pharmaceutical compounds due to its potential biological activities. Its unique structure allows it to be a promising candidate for the development of new drugs.
Used in Research and Development:
6,6-Dimethylpiperidine-2,4-dione is used as a research compound in the field of drug design and synthesis. Its properties and interactions with other molecules can provide valuable insights into the development of novel therapeutic agents.
Used in Drug Design:
6,6-Dimethylpiperidine-2,4-dione is used as a structural component in the design of new drugs, leveraging its potential biological activities and chemical properties to create innovative pharmaceuticals.
Used in Synthesis Processes:
6,6-Dimethylpiperidine-2,4-dione is used as a reactant in various chemical synthesis processes to produce a range of compounds with potential applications in different industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 5239-39-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,2,3 and 9 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 5239-39:
(6*5)+(5*2)+(4*3)+(3*9)+(2*3)+(1*9)=94
94 % 10 = 4
So 5239-39-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H11NO2/c1-7(2)4-5(9)3-6(10)8-7/h3-4H2,1-2H3,(H,8,10)
