524-07-2 Usage
Uses
Used in Pharmaceutical Industry:
5-Pyridoxic acid is used as an active pharmaceutical ingredient for the development of drugs targeting various health conditions. Its unique chemical structure allows it to interact with specific biological targets, making it a promising candidate for drug discovery and development.
Used in Chemical Synthesis:
5-Pyridoxic acid serves as a key intermediate in the synthesis of various chemical compounds, including pharmaceuticals, agrochemicals, and other specialty chemicals. Its reactivity and functional groups make it a valuable building block for creating complex molecules with specific properties and applications.
Used in Research and Development:
As a unique chemical entity, 5-pyridoxic acid is used in research and development to study its properties, reactivity, and potential applications in various fields. Researchers can use 5-pyridoxic acid to explore new reaction pathways, develop novel synthetic methods, and investigate its biological activities.
Used in Analytical Chemistry:
5-Pyridoxic acid can be employed as a reference compound or a standard in analytical chemistry for the calibration of instruments, validation of analytical methods, and quality control of chemical products. Its well-defined structure and properties make it suitable for these purposes.
Used in Material Science:
The unique chemical structure of 5-pyridoxic acid may also find applications in material science, where it could be used to develop new materials with specific properties, such as improved stability, reactivity, or selectivity. Its potential use in this field is still under exploration and may lead to innovative applications in the future.
Check Digit Verification of cas no
The CAS Registry Mumber 524-07-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,2 and 4 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 524-07:
(5*5)+(4*2)+(3*4)+(2*0)+(1*7)=52
52 % 10 = 2
So 524-07-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO4/c1-4-7(11)6(3-10)5(2-9-4)8(12)13/h2,10-11H,3H2,1H3,(H,12,13)
