52551-67-4 Usage
General Description
2-[bis(2-hydroxyethyl)amino]-5-nitrophenol is a chemical compound that is also known as octenidine dihydrochloride. It is commonly used as an antiseptic and disinfectant due to its broad-spectrum antimicrobial properties. It is effective against a wide range of bacteria, viruses, and fungi, making it a valuable ingredient in various healthcare and personal care products. Additionally, its ability to penetrate biofilms and its low potential for developing resistance make it a popular choice for combating infections. Overall, 2-[bis(2-hydroxyethyl)amino]-5-nitrophenol is a versatile and effective compound for maintaining hygiene and preventing the spread of infectious diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 52551-67-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,5,5 and 1 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 52551-67:
(7*5)+(6*2)+(5*5)+(4*5)+(3*1)+(2*6)+(1*7)=114
114 % 10 = 4
So 52551-67-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O5/c13-5-3-11(4-6-14)9-2-1-8(12(16)17)7-10(9)15/h1-2,7,13-15H,3-6H2
