525559-14-2 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
2-BENZYLSULFANYL-4-CHLORO-6-DIETHOXYMETHYL-PYRIMIDINE is used as a key intermediate in the synthesis of potential antiviral and antifungal agents. Its unique chemical structure allows for the development of new therapeutic agents to combat various viral and fungal infections.
Used in Agricultural Products:
2-BENZYLSULFANYL-4-CHLORO-6-DIETHOXYMETHYL-PYRIMIDINE has been studied for its potential application in agricultural products. Its use in this industry could lead to the development of novel pesticides or fungicides to protect crops from diseases and pests.
Used in Medicinal Chemistry and Drug Discovery:
As a pyrimidine derivative with various functional groups, 2-BENZYLSULFANYL-4-CHLORO-6-DIETHOXYMETHYL-PYRIMIDINE holds promise in the field of medicinal chemistry. Its unique structure can be further modified to create new compounds with potential therapeutic applications, contributing to the discovery of innovative drugs for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 525559-14-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,2,5,5,5 and 9 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 525559-14:
(8*5)+(7*2)+(6*5)+(5*5)+(4*5)+(3*9)+(2*1)+(1*4)=162
162 % 10 = 2
So 525559-14-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H19ClN2O2S/c1-3-20-15(21-4-2)13-10-14(17)19-16(18-13)22-11-12-8-6-5-7-9-12/h5-10,15H,3-4,11H2,1-2H3
525559-14-2Relevant academic research and scientific papers
PYRIMIDINE DERIVATIVES USED AS ITK INHIBITORS
-
Page/Page column 126-127, (2010/10/03)
The invention is directed to certain novel compounds. Specifically, the invention is directed to compounds of formula (I): and salts thereof. The compounds of the invention are inhibitors of kinase activity, in particular ltk activity.
