5256-66-6 Usage
Uses
Used in Pharmaceutical Industry:
(1alpha,2beta,5alpha)-5-(isopropyl)-2-methylcyclohexyl acetate is used as a pharmaceutical intermediate for the synthesis of various drugs. Its unique molecular structure and stereochemistry may contribute to the development of new therapeutic agents with specific biological activities.
Used in Flavor and Fragrance Industry:
Due to its complex molecular structure, (1alpha,2beta,5alpha)-5-(isopropyl)-2-methylcyclohexyl acetate is used as a component in the creation of unique fragrances and flavors. Its distinct properties can contribute to the development of novel scents and tastes in various consumer products.
Used in Chemical Research:
(1alpha,2beta,5alpha)-5-(isopropyl)-2-methylcyclohexyl acetate serves as a valuable compound for chemical research, particularly in the study of stereochemistry, molecular interactions, and the development of new synthetic methods. Its unique structure and properties make it an interesting subject for scientific investigation.
Used in Material Science:
(1alpha,2beta,5alpha)-5-(isopropyl)-2-methylcyclohexyl acetate's molecular structure and properties may also find applications in material science, where it could be utilized in the development of new materials with specific characteristics, such as improved stability, reactivity, or selectivity in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 5256-66-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,2,5 and 6 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5256-66:
(6*5)+(5*2)+(4*5)+(3*6)+(2*6)+(1*6)=96
96 % 10 = 6
So 5256-66-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H22O2/c1-8(2)11-6-5-9(3)12(7-11)14-10(4)13/h8-9,11-12H,5-7H2,1-4H3/t9-,11-,12-/m0/s1
