52576-59-7 Usage
Explanation
Different sources of media describe the Explanation of 52576-59-7 differently. You can refer to the following data:
1. The molecular formula represents the number of atoms of each element present in a molecule of the compound.
2. Anthraquinone is a group of organic compounds that have a similar structure and properties, and the compound belongs to this family.
3. The compound is known for its vibrant color, which makes it suitable for use as a dye and pigment.
4. The specific color that the compound imparts when used as a dye or pigment.
5. The compound is commonly used in various industries, such as textile, paper, and cosmetic industries, for coloring purposes.
6. The compound has a complex molecular structure, which contributes to its unique properties and potential applications.
7. Due to its unique structure and properties, the compound may have potential uses in the field of medicinal chemistry.
8. The compound is a chemical substance composed of molecules with the same molecular formula.
Family
Anthraquinone
Color
Brightly colored
Color shade
Reddish-purple
Applications
Dyeing and pigmentation
Structure
Highly complex
Potential applications
Medicinal chemistry
Chemical compound
Yes
Check Digit Verification of cas no
The CAS Registry Mumber 52576-59-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,5,7 and 6 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 52576-59:
(7*5)+(6*2)+(5*5)+(4*7)+(3*6)+(2*5)+(1*9)=137
137 % 10 = 7
So 52576-59-7 is a valid CAS Registry Number.
InChI:InChI=1/C21H15N3O6/c1-30-11-4-2-10(3-5-11)23-13-7-6-12(22)16-17(13)21(27)19-15(25)9-8-14(24(28)29)18(19)20(16)26/h2-9,23,25H,22H2,1H3