52605-87-5 Usage
Appearance
White to off-white
Functional groups
Imidazole ring
Acetic acid group
Methyl ester group
Methoxycarbonyl group
Type of compound
Methyl ester of 1H-imidazole-4-acetic acid, 5-(methoxycarbonyl)
Usage in organic synthesis
Building block for the production of various bioactive molecules and pharmaceuticals
Usage in pharmaceutical research
Building block for the production of various bioactive molecules and pharmaceuticals
Usage in the chemical industry
Synthesis of different types of compounds
Potential applications
Medical research and drug discovery
Pharmacological and biological activities
Exhibits potential for use in medical research and drug discovery due to its properties
Physical state
Solid (likely, based on appearance and molecular structure)
Check Digit Verification of cas no
The CAS Registry Mumber 52605-87-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,6,0 and 5 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 52605-87:
(7*5)+(6*2)+(5*6)+(4*0)+(3*5)+(2*8)+(1*7)=115
115 % 10 = 5
So 52605-87-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O4/c1-13-6(11)3-5-7(8(12)14-2)10-4-9-5/h4H,3H2,1-2H3,(H,9,10)
