5267-87-8 Usage
Uses
Used in Pharmaceutical Industry:
1-(2-Piperidyl)-1,2-ethanediol is used as a chiral resolving agent for the separation of enantiomers, which is essential in ensuring the desired biological activity and reducing potential side effects of drugs. 1-(2-Piperidyl)-1,2-ethanediol's ability to create specific stereochemistries is vital for the development of pharmaceuticals with precise therapeutic effects.
Used in Synthesis of Drugs and Active Pharmaceutical Ingredients:
As an intermediate, 1-(2-Piperidyl)-1,2-ethanediol plays a crucial role in the synthesis of various drugs and active pharmaceutical ingredients. Its structural features allow for the creation of new compounds with potential therapeutic applications, contributing to the advancement of medicinal chemistry.
Used in Chiral Auxiliary Applications:
1-(2-Piperidyl)-1,2-ethanediol functions as a chiral auxiliary in chemical reactions, facilitating the formation of compounds with desired stereochemistry. This is particularly important in the synthesis of complex molecules where the spatial arrangement of atoms can significantly impact the compound's biological activity and pharmacological properties.
Check Digit Verification of cas no
The CAS Registry Mumber 5267-87-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,2,6 and 7 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5267-87:
(6*5)+(5*2)+(4*6)+(3*7)+(2*8)+(1*7)=108
108 % 10 = 8
So 5267-87-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H15NO2/c9-5-7(10)6-3-1-2-4-8-6/h6-10H,1-5H2
