52751-15-2 Usage
Heterocyclic organic compound
A compound that contains a ring structure with at least one non-carbon atom (in this case, nitrogen) in its molecular structure.
Two fluorine atoms attached to a pyrazine ring
The presence of fluorine atoms influences the compound's reactivity, stability, and properties, distinguishing it from other pyrazine derivatives.
Common use in pharmaceutical and agrochemical industries
2,3-Difluoro-pyrazine serves as a building block for the synthesis of various drugs and pesticides, making it a valuable intermediate compound in these industries.
Aromatic properties
The compound has a pleasant smell and is used as a flavoring agent in the food industry, adding aroma and taste to various food products.
Potential as an insecticide
2,3-Difluoro-pyrazine has been studied for its pesticidal properties and shows promise as an effective insecticide, further expanding its applications in the agrochemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 52751-15-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,7,5 and 1 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 52751-15:
(7*5)+(6*2)+(5*7)+(4*5)+(3*1)+(2*1)+(1*5)=112
112 % 10 = 2
So 52751-15-2 is a valid CAS Registry Number.
InChI:InChI=1/C4H2F2N2/c5-3-4(6)8-2-1-7-3/h1-2H
