53-64-5 Usage
General Description
2,3-Bis(p-methoxyphenyl)-2-pentenenitrile is a chemical compound with the molecular formula C17H17NO2. It is commonly used as a reactant in organic synthesis and is known for its strong aromatic properties. 2,3-Bis(p-methoxyphenyl)-2-pentenenitrile is often utilized in the production of pharmaceuticals, dyes, and other industrial materials due to its ability to serve as a building block for more complex chemical structures. Additionally, 2,3-Bis(p-methoxyphenyl)-2-pentenenitrile is valued for its potential applications in the fields of materials science and chemistry research, making it a versatile and important chemical within the scientific community.
Check Digit Verification of cas no
The CAS Registry Mumber 53-64-5 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 5 and 3 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 53-64:
(4*5)+(3*3)+(2*6)+(1*4)=45
45 % 10 = 5
So 53-64-5 is a valid CAS Registry Number.
InChI:InChI=1/C19H19NO2/c1-4-18(14-5-9-16(21-2)10-6-14)19(13-20)15-7-11-17(22-3)12-8-15/h5-12H,4H2,1-3H3/b19-18-