53-64-5 Usage
Uses
Used in Pharmaceutical Industry:
2,3-Bis(p-methoxyphenyl)-2-pentenenitrile is used as a reactant in the synthesis of various pharmaceuticals for its ability to contribute to the formation of complex molecular structures that can exhibit therapeutic effects.
Used in Dye Industry:
In the dye industry, 2,3-Bis(p-methoxyphenyl)-2-pentenenitrile is used as a reactant for the production of dyes, leveraging its strong aromatic properties to create vibrant and stable colorants.
Used in Materials Science Research:
2,3-Bis(p-methoxyphenyl)-2-pentenenitrile is utilized as a research compound in materials science, where its unique properties are explored for potential applications in developing new materials with specific characteristics.
Used in Chemistry Research:
As a chemical with intriguing reactivity and structural features, 2,3-Bis(p-methoxyphenyl)-2-pentenenitrile is used in chemistry research to study reaction mechanisms, explore new synthetic pathways, and understand the fundamental principles of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 53-64-5 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 5 and 3 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 53-64:
(4*5)+(3*3)+(2*6)+(1*4)=45
45 % 10 = 5
So 53-64-5 is a valid CAS Registry Number.
InChI:InChI=1/C19H19NO2/c1-4-18(14-5-9-16(21-2)10-6-14)19(13-20)15-7-11-17(22-3)12-8-15/h5-12H,4H2,1-3H3/b19-18-
