53001-74-4 Usage
Uses
Used in Organic Synthesis:
2,3,4,5-Tetrafluorophenylacetonitrile is used as a building block for the synthesis of various organic compounds due to its versatile reactivity and ability to participate in a wide range of chemical reactions.
Used in Medicinal Chemistry:
In the pharmaceutical industry, 2,3,4,5-Tetrafluorophenylacetonitrile is used as a key intermediate for the development of new drugs, leveraging its reactivity to form complex molecular structures with potential therapeutic applications.
Used in Agrochemicals:
2,3,4,5-Tetrafluorophenylacetonitrile is employed as a precursor in the synthesis of agrochemicals, contributing to the development of effective pesticides and other agricultural chemicals.
Used in Transition Metal Chemistry:
As a ligand in metal-catalyzed reactions, 2,3,4,5-Tetrafluorophenylacetonitrile is utilized to enhance the efficiency and selectivity of various chemical transformations, playing a crucial role in the advancement of transition metal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 53001-74-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,0,0 and 1 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 53001-74:
(7*5)+(6*3)+(5*0)+(4*0)+(3*1)+(2*7)+(1*4)=74
74 % 10 = 4
So 53001-74-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H3F4N/c9-5-3-4(1-2-13)6(10)8(12)7(5)11/h3H,1H2
