53001-74-4 Usage
General Description
2,3,4,5-Tetrafluorophenylacetonitrile is a chemical compound with the molecular formula C8H4F4N and a molecular weight of 197.12 g/mol. It is a nitrile compound containing a benzene ring with four fluorine atoms attached at different positions. This chemical is commonly used in organic synthesis and medicinal chemistry as a building block for the synthesis of various pharmaceuticals and agrochemicals. It is known for its versatile reactivity and its ability to participate in a wide range of chemical reactions, including catalytic hydrogenation, nucleophilic substitution, and cross-coupling reactions. Additionally, 2,3,4,5-Tetrafluorophenylacetonitrile is known for its potential as a ligand in metal-catalyzed reactions, making it an important chemical in the field of transition metal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 53001-74-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,0,0 and 1 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 53001-74:
(7*5)+(6*3)+(5*0)+(4*0)+(3*1)+(2*7)+(1*4)=74
74 % 10 = 4
So 53001-74-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H3F4N/c9-5-3-4(1-2-13)6(10)8(12)7(5)11/h3H,1H2
