530141-39-0 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
Sodium 3,5-difluorobenzoate is used as an intermediate in the production of various pharmaceuticals and agrochemicals. Its unique chemical structure allows for the synthesis of a wide range of active ingredients, contributing to the development of new and improved products in these industries.
Used in Organic Synthesis:
As a building block in organic synthesis, sodium 3,5-difluorobenzoate is employed in the creation of various organic compounds. Its reactivity and functional groups make it a valuable component in the synthesis of complex organic molecules, facilitating the development of new chemical entities with potential applications in various fields.
Used in Personal Care and Cosmetic Products:
Sodium 3,5-difluorobenzoate is used as a preservative in personal care and cosmetic products due to its bactericidal properties. Its ability to inhibit the growth of microorganisms helps maintain the stability and safety of these products, ensuring their efficacy and longevity.
Used in Food Industry:
In the food industry, sodium 3,5-difluorobenzoate is utilized as a food additive for its flavor-enhancing and preservative properties. It helps improve the taste and aroma of food products while extending their shelf life, making it a valuable ingredient in the production of various food items.
Check Digit Verification of cas no
The CAS Registry Mumber 530141-39-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,3,0,1,4 and 1 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 530141-39:
(8*5)+(7*3)+(6*0)+(5*1)+(4*4)+(3*1)+(2*3)+(1*9)=100
100 % 10 = 0
So 530141-39-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H4F2O2.Na/c8-5-1-4(7(10)11)2-6(9)3-5;/h1-3H,(H,10,11);/q;+1/p-1
