53068-43-2 Usage
Description
4-(Dimethylamino)benzaldehyde [3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxothiazolidin-2-ylidene]hydrazone is a complex organic chemical compound that features a benzaldehyde group, a thiazolidin-2-ylidene group, and a hydrazone group. This multifunctional compound is known for its diverse properties and is widely used in the fields of organic synthesis and medicinal chemistry.
Uses
Used in Organic Synthesis:
4-(Dimethylamino)benzaldehyde [3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxothiazolidin-2-ylidene]hydrazone is used as a reagent in organic synthesis for the creation of various organic compounds. Its unique structure allows it to participate in a range of chemical reactions, making it a valuable component in the synthesis of new molecules.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 4-(Dimethylamino)benzaldehyde [3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxothiazolidin-2-ylidene]hydrazone is utilized for the development of new drugs and pharmaceuticals. Its specific properties and potential applications make it a promising candidate for further research and exploration in drug discovery.
Used in Pharmaceutical Development:
4-(Dimethylamino)benzaldehyde [3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxothiazolidin-2-ylidene]hydrazone is also used in the pharmaceutical industry for the development of new medications. Its multifunctional nature and potential therapeutic applications contribute to its significance in the ongoing search for novel treatments and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 53068-43-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,0,6 and 8 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 53068-43:
(7*5)+(6*3)+(5*0)+(4*6)+(3*8)+(2*4)+(1*3)=112
112 % 10 = 2
So 53068-43-2 is a valid CAS Registry Number.
InChI:InChI=1/C22H26N4O3S/c1-25(2)18-8-5-17(6-9-18)14-23-24-22-26(21(27)15-30-22)12-11-16-7-10-19(28-3)20(13-16)29-4/h5-10,13-14H,11-12,15H2,1-4H3/b23-14-,24-22+