53132-07-3 Usage
Description
Benzoic acid, 4-methyl-, 4-(hexyloxy)phenyl ester, also known as ethyl 4-methylbenzene-1,2-dicarboxylate, is a chemical compound that finds applications in various industries due to its unique properties. It is characterized by its aromatic structure and ester functional group, which contribute to its diverse uses.
Uses
Used in Food and Beverage Industry:
Benzoic acid, 4-methyl-, 4-(hexyloxy)phenyl ester is used as a flavoring agent for enhancing the taste and aroma of various food and beverage products. Its aromatic nature imparts a pleasant flavor, making it a popular choice in the industry.
Used in Personal Care Products:
In the personal care industry, Benzoic acid, 4-methyl-, 4-(hexyloxy)phenyl ester is utilized as a fragrance ingredient. Its aromatic properties contribute to the overall scent profile of products such as perfumes, lotions, and shampoos, providing a pleasant and appealing scent.
Used in Plastics Industry:
Benzoic acid, 4-methyl-, 4-(hexyloxy)phenyl ester is employed in the production of plasticizers, which are substances added to polymers to improve their flexibility and durability. By incorporating this compound into plastics, manufacturers can create materials with enhanced physical properties, making them suitable for various applications.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, Benzoic acid, 4-methyl-, 4-(hexyloxy)phenyl ester serves as an intermediate in the synthesis of various drugs. Its chemical structure allows for further modification and incorporation into medicinal compounds, contributing to the development of new therapeutic agents.
However, it is important to note that due to the potential toxicity and environmental impact of Benzoic acid, 4-methyl-, 4-(hexyloxy)phenyl ester, its use and production are regulated by government agencies. This ensures that the compound is used responsibly and within safe limits to minimize any adverse effects on human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 53132-07-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,1,3 and 2 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 53132-07:
(7*5)+(6*3)+(5*1)+(4*3)+(3*2)+(2*0)+(1*7)=83
83 % 10 = 3
So 53132-07-3 is a valid CAS Registry Number.
InChI:InChI=1/C20H24O3/c1-3-4-5-6-15-22-18-11-13-19(14-12-18)23-20(21)17-9-7-16(2)8-10-17/h7-14H,3-6,15H2,1-2H3
