531529-72-3 Usage
Uses
Used in Pharmaceutical Industry:
Benzoic acid, 2-amino-3,4,5-trifluoro(9CI) is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with improved therapeutic properties and reduced side effects.
Used in Agrochemical Industry:
In the agrochemical industry, Benzoic acid, 2-amino-3,4,5-trifluoro(9CI) serves as a crucial building block for the production of various agrochemical products. Its incorporation into these products can enhance their effectiveness in pest control and crop protection.
Used in Chemical Manufacturing:
Benzoic acid, 2-amino-3,4,5-trifluoro(9CI) is utilized as an intermediate in the production of a wide range of organic compounds. Its unique substitution pattern allows for the creation of novel chemical entities with diverse applications in various industries.
Used in Research and Development:
Due to its unique structure and potential applications, Benzoic acid, 2-amino-3,4,5-trifluoro(9CI) is a valuable compound for research and development purposes. It can be used to explore new chemical reactions, synthesis pathways, and potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 531529-72-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,3,1,5,2 and 9 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 531529-72:
(8*5)+(7*3)+(6*1)+(5*5)+(4*2)+(3*9)+(2*7)+(1*2)=143
143 % 10 = 3
So 531529-72-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H4F3NO2/c8-3-1-2(7(12)13)6(11)5(10)4(3)9/h1H,11H2,(H,12,13)
531529-72-3Relevant academic research and scientific papers
Laeva,Nosova,Lipunova,Golovchenko,Adonin,Parmon,Charushin
, p. 913 - 920 (2009)
Reactions of fluorine-containing 3,1-benzoxazin-4-ones with ammonium acetate, hydrazine, and heteroaromatic amines gave new 3H-, 3-amino-, and 3-hetarylquinazolin-4-ones, respectively. Differences in the conditions of formation of benzoxazinones from anthranilic acids with different fluorination patterns and in the reactions of fluorinated 3,1-benzoxazinones with nitrogen-centered nucleophiles were revealed. Pleiades Publishing, Ltd., 2009.
