53197-77-6 Usage
Uses
Used in Analytical Chemistry:
2,6-Diamino-9H-fluoren-9-one is utilized as an indicator in analytical chemistry for its fluorescent properties, which aid in the detection and measurement of various substances. Its ability to fluoresce under specific conditions enhances the sensitivity and accuracy of analytical techniques.
Used in DNA Research:
In the field of molecular biology, 2,6-Diamino-9H-fluoren-9-one serves as a marker in DNA research. Its fluorescent characteristics allow for the tracking and visualization of DNA molecules, facilitating studies on DNA structure, function, and interactions with other molecules.
Used in Color Photographic Materials:
2,6-Diamino-9H-fluoren-9-one is employed as a sensitizer in the production of color photographic materials. Its role in enhancing the sensitivity of photographic emulsions to light contributes to the development of high-quality color images with improved resolution and contrast.
Used in Chemical and Material Science:
As a versatile chemical, 2,6-Diamino-9H-fluoren-9-one is applied in various chemical reactions and material synthesis processes. Its unique properties and reactivity make it a valuable component in the creation of new compounds and materials with specific properties for diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 53197-77-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,1,9 and 7 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 53197-77:
(7*5)+(6*3)+(5*1)+(4*9)+(3*7)+(2*7)+(1*7)=136
136 % 10 = 6
So 53197-77-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H10N2O/c14-7-2-4-10-11(5-7)9-3-1-8(15)6-12(9)13(10)16/h1-6H,14-15H2
