53242-19-6 Usage
Uses
Used in Pharmaceutical Research:
3-Pyridinamine, 5,6-dibromois used as a building block in pharmaceutical research for the development of various pharmaceuticals. Its unique structure and properties make it a valuable component in the synthesis of new drugs with potential therapeutic applications.
Used in Agrochemical Production:
3-Pyridinamine, 5,6-dibromois also used as a building block in the production of agrochemicals. Its chemical properties allow it to be incorporated into the development of new pesticides, herbicides, and other agricultural chemicals to improve crop yields and protect against pests.
Used in Organic Synthesis:
In the field of organic synthesis, 3-Pyridinamine, 5,6-dibromoserves as a key intermediate for the synthesis of various organic compounds. Its reactivity and functional groups make it a versatile component in the preparation of complex organic molecules.
Used in Biological Activity Studies:
3-Pyridinamine, 5,6-dibromohas been studied for its potential biological activities and pharmacological properties. Researchers are exploring its applications in the development of new therapeutic agents, particularly in the areas of cancer treatment, neurodegenerative diseases, and other medical conditions.
Note: The specific uses and applications of 3-Pyridinamine, 5,6-dibromoare still being explored and researched in the scientific community. As more information becomes available, its potential applications may expand further.
Check Digit Verification of cas no
The CAS Registry Mumber 53242-19-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,2,4 and 2 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 53242-19:
(7*5)+(6*3)+(5*2)+(4*4)+(3*2)+(2*1)+(1*9)=96
96 % 10 = 6
So 53242-19-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H4Br2N2/c6-4-1-3(8)2-9-5(4)7/h1-2H,8H2
