53268-33-0 Usage
Uses
Used in Pharmaceutical Industry:
NSC306665 is used as a synthetic intermediate for the development of pharmaceutical agents. Its unique structure allows for the creation of a wide range of compounds with diverse therapeutic applications, making it a valuable asset in the pharmaceutical industry.
Used in Anticancer Applications:
NSC306665 can be used as a building block for the synthesis of anticancer drugs. Its chemical properties enable the development of compounds that can target specific cancer-related pathways, potentially leading to the creation of novel and effective treatments for various types of cancer.
Used in Drug Delivery Systems:
NSC306665 can also be employed in the development of drug delivery systems. Its structural properties can be utilized to design carriers for targeted drug delivery, potentially improving the bioavailability and therapeutic outcomes of various pharmaceutical agents.
Check Digit Verification of cas no
The CAS Registry Mumber 53268-33-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,2,6 and 8 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 53268-33:
(7*5)+(6*3)+(5*2)+(4*6)+(3*8)+(2*3)+(1*3)=120
120 % 10 = 0
So 53268-33-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N3S/c7-5-2-1-4(3-9-5)6(8)10/h1-3H,(H2,7,9)(H2,8,10)
