53279-31-5 Usage
General Description
2,4-dihydroxy-6-(1-hydroxy-2-oxopropyl)benzoic acid is a chemical compound with a molecular formula C10H10O7. It is a derivative of benzoic acid and is also known as gentisic acid. 2,4-dihydroxy-6-(1-hydroxy-2-oxopropyl)benzoic acid is a white crystalline solid and is found in various plants such as the sugar maple. It has antioxidant properties and has been studied for its potential use in the treatment of various diseases such as diabetes and inflammation. 2,4-dihydroxy-6-(1-hydroxy-2-oxopropyl)benzoic acid is also used in the synthesis of various pharmaceuticals and as a reagent in organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 53279-31-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,2,7 and 9 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 53279-31:
(7*5)+(6*3)+(5*2)+(4*7)+(3*9)+(2*3)+(1*1)=125
125 % 10 = 5
So 53279-31-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H10O6/c1-4(11)9(14)6-2-5(12)3-7(13)8(6)10(15)16/h2-3,9,12-14H,1H3,(H,15,16)
