5331-87-3 Usage
Description
3,3'-DICHLORODIPHENYL 4,4'-DIISOCYANATE, also known as p,p'-Dichlorodiphenylmethane-4,4'-diisocyanate or Toluene diisocyanate, is a chemical compound that serves as a crucial ingredient in the production of polyurethane foams and coatings. It is recognized for its powerful irritant properties, affecting the skin, eyes, and respiratory system, and its potential carcinogenic nature, which necessitates strict handling and safety measures to mitigate health risks.
Used in Polyurethane Industry:
3,3'-DICHLORODIPHENYL 4,4'-DIISOCYANATE is used as a key chemical component for the production of polyurethane foams, which are versatile materials with applications in various industries due to their unique properties such as flexibility, durability, and insulation capabilities.
Used in Coatings Industry:
In the coatings industry, 3,3'-DICHLORODIPHENYL 4,4'-DIISOCYANATE is utilized as a critical constituent in the formulation of coatings that offer specific characteristics like durability, resistance to wear, and protection against environmental factors. Its role in these coatings is essential for achieving desired performance standards.
Check Digit Verification of cas no
The CAS Registry Mumber 5331-87-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,3,3 and 1 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5331-87:
(6*5)+(5*3)+(4*3)+(3*1)+(2*8)+(1*7)=83
83 % 10 = 3
So 5331-87-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H6Cl2N2O2/c15-11-5-9(1-3-13(11)17-7-19)10-2-4-14(18-8-20)12(16)6-10/h1-6H
