5334-99-6 Usage
Uses
Used in Pharmaceutical Industry:
1H-Pyrazolo[3,4-d]pyrimidin-4-amine, 1-methyl(9CI) is used as a chemical intermediate for the synthesis of various medicines. Its unique structure and properties make it a valuable component in the development of drugs for different therapeutic applications. 1H-Pyrazolo[3,4-d]pyrimidin-4-amine, 1-methyl(9CI)'s versatility in chemical reactions allows for the creation of a wide range of pharmaceutical products.
Check Digit Verification of cas no
The CAS Registry Mumber 5334-99-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,3,3 and 4 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 5334-99:
(6*5)+(5*3)+(4*3)+(3*4)+(2*9)+(1*9)=96
96 % 10 = 6
So 5334-99-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N5/c1-11-6-4(2-10-11)5(7)8-3-9-6/h2-3H,1H3,(H2,7,8,9)
5334-99-6Relevant academic research and scientific papers
Synthesis and characterization of two novel organic-inorganic compounds based on tetrahexyl and Tetraheptyl ammonium ions and the preyssler anion and their catalytic activities in the synthesis of 4-aminopyrazolo[3,4-d]- pyrimidines
Bamoharram, Fatemeh Farrash
experimental part, p. 2509 - 2519 (2010/07/15)
Two novel organic-inorganic compounds based on tetrahexylammonium (THA) and tetraheptylammonium (THPA) ions and the Preyssler anion, [NaP5W30O110]14-, were synthesized and formulated as (THA)7.7H6.3 [NaP5W30O110] (A) and (THPA)7.5 H6.5[N aP5W30O110] (B).
