5339-50-4 Usage
Uses
Used in Agriculture:
[(4,6-Diamino-s-triazin-2-yl)thio]acetic acid sodium salt is used as a chelating agent for enhancing the bioavailability and uptake of essential metal nutrients in plants. Its ability to form stable complexes with metal ions helps improve crop yield and quality by ensuring that plants receive the necessary nutrients for optimal growth.
Used in Pharmaceuticals:
In the pharmaceutical industry, [(4,6-Diamino-s-triazin-2-yl)thio]acetic acid sodium salt is utilized as a chelating agent in the development of drugs that require metal ion coordination. This application aids in the synthesis of new pharmaceutical compounds and can potentially improve the efficacy and stability of existing medications.
Used in Water Treatment:
[(4,6-Diamino-s-triazin-2-yl)thio]acetic acid sodium salt is employed as a chelating agent in water treatment processes. It helps remove heavy metal ions from water by forming stable complexes, which can then be easily filtered out. This application contributes to the purification of water supplies and the prevention of water pollution caused by heavy metal contamination.
Overall, [(4,6-Diamino-s-triazin-2-yl)thio]acetic acid sodium salt is a versatile compound with potential uses in various chemical and industrial processes, including agriculture, pharmaceuticals, and water treatment. Its chelating properties make it a valuable asset in these fields, where the formation of stable complexes with metal ions is crucial for achieving desired outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 5339-50-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,3,3 and 9 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 5339-50:
(6*5)+(5*3)+(4*3)+(3*9)+(2*5)+(1*0)=94
94 % 10 = 4
So 5339-50-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H7N5O2S/c6-3-8-4(7)10-5(9-3)13-1-2(11)12/h1H2,(H,11,12)(H4,6,7,8,9,10)