53478-90-3 Usage
Chemical class
Ammonium salts It belongs to a group of positively charged ions that are derived from ammonia.
Quaternary ammonium compound
Positively charged with four organic substituents The compound has a central nitrogen atom with a positive charge, surrounded by four organic groups.
Pharmaceutical research and drug development
Used in the synthesis of new drugs It serves as a building block or intermediate in the development of various therapeutic agents.
Antiviral properties
Potential antiviral activity The compound has been studied for its ability to inhibit viral replication or infection.
Antimicrobial properties
Potential antimicrobial activity It has been investigated for its ability to inhibit the growth of bacteria and other microorganisms.
Neurotransmitter receptor modulation
Role in modulating neurotransmitter receptors The compound may interact with receptors in the brain, affecting the communication between neurons.
Neurological and psychiatric research
Potential candidate for studying neurological and psychiatric disorders Due to its interaction with neurotransmitter receptors, it may be useful in understanding and treating various brain-related conditions.
Versatile compound
Wide range of potential applications The compound's properties make it suitable for various applications in medicine and neuroscience.
Chemical structure
10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylammonium chloride This complex structure is responsible for the compound's unique properties and potential applications.
Charge
Positively charged The compound has a net positive charge due to the presence of the quaternary ammonium group.
Check Digit Verification of cas no
The CAS Registry Mumber 53478-90-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,4,7 and 8 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 53478-90:
(7*5)+(6*3)+(5*4)+(4*7)+(3*8)+(2*9)+(1*0)=143
143 % 10 = 3
So 53478-90-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H15N.ClH/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15;/h1-8,15H,9-10,16H2;1H
