53483-70-8 Usage
Uses
Used in Chemical Research:
p-nitrobenzyl (6R-trans)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate monohydrochloride is used as a research compound for exploring its chemical properties and potential interactions with other molecules. Its complex structure and functional groups make it a valuable subject for studies in synthetic chemistry and chemical reactions.
Used in Biochemical Studies:
In the field of biochemistry, p-nitrobenzyl (6R-trans)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate monohydrochloride is employed as a tool to investigate its interactions with biological systems. Its unique structure and functional groups may allow it to bind to specific biological targets, making it a candidate for studies on enzyme inhibition, receptor binding, or other biochemical processes.
Used in Drug Discovery:
p-nitrobenzyl (6R-trans)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate monohydrochloride is used as a lead compound in drug discovery. Its structural features may provide a basis for the development of new pharmaceutical agents, particularly in the areas of medicinal chemistry and drug design. Researchers may use p-nitrobenzyl (6R-trans)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate monohydrochloride as a starting point for the synthesis of new drugs with potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 53483-70-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,4,8 and 3 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 53483-70:
(7*5)+(6*3)+(5*4)+(4*8)+(3*3)+(2*7)+(1*0)=128
128 % 10 = 8
So 53483-70-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H12ClN3O5S.ClH/c15-9-6-24-13-10(16)12(19)17(13)11(9)14(20)23-5-7-1-3-8(4-2-7)18(21)22;/h1-4,10,13H,5-6,16H2;1H/t10-,13-;/m1./s1
