53483-70-8 Usage
General Description
p-Nitrobenzyl (6R-trans)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate monohydrochloride is a chemical compound often used in research pertaining to the fields of chemistry and biochemistry. It's a derivative of cyclic structures and involves multiple functional groups including a nitrobenzyl group, an amino group, and a carboxylate group. p-nitrobenzyl (6R-trans)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate monohydrochloride also contains specific features such as a bicyclic structure and a chloro group. Being a monohydrochloride, it has one attached hydrochloride group to its molecular structure. Despite its long and complex name indicating its various structural elements, its specific uses, properties, and applications largely depend on the context of the scientific investigation or research in which it's used.
Check Digit Verification of cas no
The CAS Registry Mumber 53483-70-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,4,8 and 3 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 53483-70:
(7*5)+(6*3)+(5*4)+(4*8)+(3*3)+(2*7)+(1*0)=128
128 % 10 = 8
So 53483-70-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H12ClN3O5S.ClH/c15-9-6-24-13-10(16)12(19)17(13)11(9)14(20)23-5-7-1-3-8(4-2-7)18(21)22;/h1-4,10,13H,5-6,16H2;1H/t10-,13-;/m1./s1
