53503-86-9 Usage
Uses
Used in Pharmaceutical Drug Synthesis:
2,5-dimethylpiperazine-1,4-diethanol is utilized as a building block for the creation of various pharmaceutical drugs. Its unique molecular structure allows for the development of new molecules with specific targeting and activity profiles, which is crucial for drug development. It is particularly noted for its potential in the production of antipsychotic and analgesic medications.
Used in Organic Synthesis:
In the realm of organic synthesis, 2,5-dimethylpiperazine-1,4-diethanol serves as a valuable reagent. Its chemical properties make it suitable for use in the synthesis of a wide range of organic compounds, contributing to the diversity of chemical products.
Used in Materials Science:
2,5-dimethylpiperazine-1,4-diethanol also finds applications in materials science. Its molecular structure lends itself to the production of various polymers and materials that can be used in industrial and research applications, broadening its utility beyond pharmaceuticals.
Used in Industrial Applications:
2,5-dimethylpiperazine-1,4-diethanol's potential as a building block extends to industrial applications, where it may be incorporated into the development of new materials with specific properties required for various uses in industry.
Check Digit Verification of cas no
The CAS Registry Mumber 53503-86-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,5,0 and 3 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 53503-86:
(7*5)+(6*3)+(5*5)+(4*0)+(3*3)+(2*8)+(1*6)=109
109 % 10 = 9
So 53503-86-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H22N2O2/c1-9-7-12(4-6-14)10(2)8-11(9)3-5-13/h9-10,13-14H,3-8H2,1-2H3
