53514-58-2 Usage
Description
(5Z)-5-[(4-nitrophenyl)methylidene]-3-phenyl-2-sulfanylidene-imidazolidin-4-one is a complex organic molecule with a molecular formula of C15H11N3O3S. It is part of the imidazolidin-4-one group and features a nitrophenyl group, a phenyl group, and a sulfanylidene group. (5Z)-5-[(4-nitrophenyl)methylidene]-3-phenyl-2-sulfanylidene-imidazolidin-4-one holds potential pharmacological properties and is considered for use in the development of pharmaceutical drugs. Further experimental research is necessary to determine its exact properties and possible applications.
Uses
Used in Pharmaceutical Industry:
(5Z)-5-[(4-nitrophenyl)methylidene]-3-phenyl-2-sulfanylidene-imidazolidin-4-one is used as a potential pharmaceutical compound for its possible pharmacological properties. (5Z)-5-[(4-nitrophenyl)methylidene]-3-phenyl-2-sulfanylidene-imidazolidin-4-one's unique structure, which includes a nitrophenyl group, a phenyl group, and a sulfanylidene group, suggests that it may have applications in the development of new drugs. However, further research is required to explore its specific uses and effectiveness in this industry.
Used in Chemical Research:
(5Z)-5-[(4-nitrophenyl)methylidene]-3-phenyl-2-sulfanylidene-imidazolidin-4-one is used as a subject of study in chemical research for understanding its properties, reactivity, and potential interactions with other molecules. (5Z)-5-[(4-nitrophenyl)methylidene]-3-phenyl-2-sulfanylidene-imidazolidin-4-one's structure and the presence of various functional groups make it an interesting candidate for exploring new chemical reactions and mechanisms, which could lead to the discovery of novel applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 53514-58-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,5,1 and 4 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 53514-58:
(7*5)+(6*3)+(5*5)+(4*1)+(3*4)+(2*5)+(1*8)=112
112 % 10 = 2
So 53514-58-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H11N3O3S/c20-15-14(10-11-6-8-13(9-7-11)19(21)22)17-16(23)18(15)12-4-2-1-3-5-12/h1-10H,(H,17,23)/b14-10-