53520-49-3 Usage
Uses
Used in Pharmaceutical Industry:
(1E)-1-hydroxyiminohexan-2-one is used as a synthetic intermediate for the production of various pharmaceuticals. Its ability to undergo different chemical reactions allows for the creation of a wide range of functionalized compounds, making it a valuable component in the development of new drugs.
Used in Agrochemical Industry:
(1E)-1-hydroxyiminohexan-2-one is used as a building block in the synthesis of agrochemicals. Its versatility in organic synthesis enables the production of various compounds that can be used in the development of pesticides, herbicides, and other agricultural products.
Used in Fine Chemicals Industry:
(1E)-1-hydroxyiminohexan-2-one is used as a key component in the production of fine chemicals. Its unique structure and reactivity make it an important reagent in the synthesis of specialty chemicals used in various industries, such as fragrances, dyes, and coatings.
Used in Asymmetrical Synthesis:
(1E)-1-hydroxyiminohexan-2-one is used as a chiral auxiliary in asymmetrical synthesis. Its ability to induce enantioselectivity in chemical reactions makes it a crucial compound for the preparation of enantiomerically pure molecules, which are essential in various applications, including pharmaceuticals and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 53520-49-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,5,2 and 0 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 53520-49:
(7*5)+(6*3)+(5*5)+(4*2)+(3*0)+(2*4)+(1*9)=103
103 % 10 = 3
So 53520-49-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO2/c1-2-3-4-6(8)5-7-9/h5,9H,2-4H2,1H3/b7-5+
