53532-37-9 Usage
Type of Compound
Heterocyclic compound
Composition
Contains sulfur (S), nitrogen (N), and oxygen (O) atoms
Applications
Organic Synthesis: Used as a building block in organic chemistry
Medicinal Chemistry: Employed in the synthesis of pharmaceuticals and biologically active molecules
Properties
Antioxidant: Exhibits potential antioxidant properties
Pharmacological: Shows promise in pharmacological applications
Utility
Therapeutic Applications: Studied for potential therapeutic uses
Coordination Chemistry: Functions as a ligand in coordination chemistry
Catalysis: Utilized in catalytic processes
Check Digit Verification of cas no
The CAS Registry Mumber 53532-37-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,5,3 and 2 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 53532-37:
(7*5)+(6*3)+(5*5)+(4*3)+(3*2)+(2*3)+(1*7)=109
109 % 10 = 9
So 53532-37-9 is a valid CAS Registry Number.
InChI:InChI=1/C4H7N3O2S/c8-2-7(3-9)4-6-5-1-10-4/h1,8-9H,2-3H2
